C11H20N4O4S — CID 60918354
6-amino-1-butyl-5-(2-methylsulfonylethylamino)pyrimidine-2,4-dione (PubChem CID 60918354) has the molecular formula C11H20N4O4S and a molecular weight of 304.37 g/mol. Its IUPAC name is 6-amino-1-butyl-5-(2-methylsulfonylethylamino)pyrimidine-2,4-dione.
| Compound Name | 6-amino-1-butyl-5-(2-methylsulfonylethylamino)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 60918354 |
| Molecular Formula | C11H20N4O4S |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | 6-amino-1-butyl-5-(2-methylsulfonylethylamino)pyrimidine-2,4-dione |
| SMILES | CCCCn1c(N)c(NCCS(C)(=O)=O)c(=O)[nH]c1=O |
| InChI | InChI=1S/C11H20N4O4S/c1-3-4-6-15-9(12)8(10(16)14-11(15)17)13-5-7-20(2,18)19/h13H,3-7,12H2,1-2H3,(H,14,16,17) |
| InChIKey | BKULEGKPPNJTLQ-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 127.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |