C12H22N4O3 — CID 60649021
6-amino-1-butyl-5-(3-methoxypropylamino)pyrimidine-2,4-dione (PubChem CID 60649021) has the molecular formula C12H22N4O3 and a molecular weight of 270.33 g/mol. Its IUPAC name is 6-amino-1-butyl-5-(3-methoxypropylamino)pyrimidine-2,4-dione.
| Compound Name | 6-amino-1-butyl-5-(3-methoxypropylamino)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 60649021 |
| Molecular Formula | C12H22N4O3 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | 6-amino-1-butyl-5-(3-methoxypropylamino)pyrimidine-2,4-dione |
| SMILES | CCCCn1c(N)c(NCCCOC)c(=O)[nH]c1=O |
| InChI | InChI=1S/C12H22N4O3/c1-3-4-7-16-10(13)9(11(17)15-12(16)18)14-6-5-8-19-2/h14H,3-8,13H2,1-2H3,(H,15,17,18) |
| InChIKey | LKLSKDHXTPTVOU-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 102.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|