C13H23N5O3 — CID 106238995
5-[(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)amino]pentanamide (PubChem CID 106238995) has the molecular formula C13H23N5O3 and a molecular weight of 297.36 g/mol. Its IUPAC name is 5-[(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)amino]pentanamide.
| Compound Name | 5-[(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)amino]pentanamide |
|---|---|
| PubChem CID | 106238995 |
| Molecular Formula | C13H23N5O3 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.18 |
| IUPAC Name | 5-[(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)amino]pentanamide |
| SMILES | CCCCn1c(N)c(NCCCCC(N)=O)c(=O)[nH]c1=O |
| InChI | InChI=1S/C13H23N5O3/c1-2-3-8-18-11(15)10(12(20)17-13(18)21)16-7-5-4-6-9(14)19/h16H,2-8,15H2,1H3,(H2,14,19)(H,17,20,21) |
| InChIKey | CLQXGIWUNKZAHN-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 136.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|