C12H22N4O4 — CID 104762438
6-amino-1-(2-methoxyethyl)-5-(2-propan-2-yloxyethylamino)pyrimidine-2,4-dione (PubChem CID 104762438) has the molecular formula C12H22N4O4 and a molecular weight of 286.33 g/mol. Its IUPAC name is 6-amino-1-(2-methoxyethyl)-5-(2-propan-2-yloxyethylamino)pyrimidine-2,4-dione.
| Compound Name | 6-amino-1-(2-methoxyethyl)-5-(2-propan-2-yloxyethylamino)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 104762438 |
| Molecular Formula | C12H22N4O4 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.16 |
| IUPAC Name | 6-amino-1-(2-methoxyethyl)-5-(2-propan-2-yloxyethylamino)pyrimidine-2,4-dione |
| SMILES | COCCn1c(N)c(NCCOC(C)C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C12H22N4O4/c1-8(2)20-6-4-14-9-10(13)16(5-7-19-3)12(18)15-11(9)17/h8,14H,4-7,13H2,1-3H3,(H,15,17,18) |
| InChIKey | NSDCLEMLJRNJPH-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 111.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|