C7H10BrN3O3 — CID 2389933
6-amino-5-bromo-1-(2-methoxyethyl)pyrimidine-2,4-dione (PubChem CID 2389933) has the molecular formula C7H10BrN3O3 and a molecular weight of 264.08 g/mol. Its IUPAC name is 6-amino-5-bromo-1-(2-methoxyethyl)pyrimidine-2,4-dione.
| Compound Name | 6-amino-5-bromo-1-(2-methoxyethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 2389933 |
| Molecular Formula | C7H10BrN3O3 |
| Molecular Weight | 264.08 g/mol |
| Exact Mass | 262.99 |
| IUPAC Name | 6-amino-5-bromo-1-(2-methoxyethyl)pyrimidine-2,4-dione |
| SMILES | COCCn1c(N)c(Br)c(=O)[nH]c1=O |
| InChI | InChI=1S/C7H10BrN3O3/c1-14-3-2-11-5(9)4(8)6(12)10-7(11)13/h2-3,9H2,1H3,(H,10,12,13) |
| InChIKey | UGMDAXMHQYFURQ-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 90.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.08 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |