C12H14N4O3 — CID 142647674
2-amino-4-(2,4-dioxo-1H-quinazolin-3-yl)butanamide (PubChem CID 142647674) has the molecular formula C12H14N4O3 and a molecular weight of 262.27 g/mol. Its IUPAC name is 2-amino-4-(2,4-dioxo-1H-quinazolin-3-yl)butanamide.
| Compound Name | 2-amino-4-(2,4-dioxo-1H-quinazolin-3-yl)butanamide |
|---|---|
| PubChem CID | 142647674 |
| Molecular Formula | C12H14N4O3 |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | 2-amino-4-(2,4-dioxo-1H-quinazolin-3-yl)butanamide |
| SMILES | NC(=O)C(N)CCn1c(=O)[nH]c2ccccc2c1=O |
| InChI | InChI=1S/C12H14N4O3/c13-8(10(14)17)5-6-16-11(18)7-3-1-2-4-9(7)15-12(16)19/h1-4,8H,5-6,13H2,(H2,14,17)(H,15,19) |
| InChIKey | FGSRRTLRAKIVLF-UHFFFAOYSA-N |
| XLogP | -1.11 |
| TPSA | 123.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |