C17H14N2O5 — CID 51114624
(2-methoxyphenyl) 2-(2,4-dioxo-1H-quinazolin-3-yl)acetate (PubChem CID 51114624) has the molecular formula C17H14N2O5 and a molecular weight of 326.31 g/mol. Its IUPAC name is (2-methoxyphenyl) 2-(2,4-dioxo-1H-quinazolin-3-yl)acetate.
| Compound Name | (2-methoxyphenyl) 2-(2,4-dioxo-1H-quinazolin-3-yl)acetate |
|---|---|
| PubChem CID | 51114624 |
| Molecular Formula | C17H14N2O5 |
| Molecular Weight | 326.31 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | (2-methoxyphenyl) 2-(2,4-dioxo-1H-quinazolin-3-yl)acetate |
| SMILES | COc1ccccc1OC(=O)Cn1c(=O)[nH]c2ccccc2c1=O |
| InChI | InChI=1S/C17H14N2O5/c1-23-13-8-4-5-9-14(13)24-15(20)10-19-16(21)11-6-2-3-7-12(11)18-17(19)22/h2-9H,10H2,1H3,(H,18,22) |
| InChIKey | GZCIXOREKSUNFO-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.31 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|