C21H23N3O4 — CID 39043523
4-(2,4-dioxo-1H-quinazolin-3-yl)-N-[2-(2-methoxyphenyl)ethyl]butanamide (PubChem CID 39043523) has the molecular formula C21H23N3O4 and a molecular weight of 381.43 g/mol. Its IUPAC name is 4-(2,4-dioxo-1H-quinazolin-3-yl)-N-[2-(2-methoxyphenyl)ethyl]butanamide.
| Compound Name | 4-(2,4-dioxo-1H-quinazolin-3-yl)-N-[2-(2-methoxyphenyl)ethyl]butanamide |
|---|---|
| PubChem CID | 39043523 |
| Molecular Formula | C21H23N3O4 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | 4-(2,4-dioxo-1H-quinazolin-3-yl)-N-[2-(2-methoxyphenyl)ethyl]butanamide |
| SMILES | COc1ccccc1CCNC(=O)CCCn1c(=O)[nH]c2ccccc2c1=O |
| InChI | InChI=1S/C21H23N3O4/c1-28-18-10-5-2-7-15(18)12-13-22-19(25)11-6-14-24-20(26)16-8-3-4-9-17(16)23-21(24)27/h2-5,7-10H,6,11-14H2,1H3,(H,22,25)(H,23,27) |
| InChIKey | KQPHIESQUGKMCV-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 93.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |