C24H29N3O5 — CID 15988281
6-(6,7-dimethoxy-2,4-dioxo-1H-quinazolin-3-yl)-N-(2-phenylethyl)hexanamide (PubChem CID 15988281) has the molecular formula C24H29N3O5 and a molecular weight of 439.51 g/mol. Its IUPAC name is 6-(6,7-dimethoxy-2,4-dioxo-1H-quinazolin-3-yl)-N-(2-phenylethyl)hexanamide.
| Compound Name | 6-(6,7-dimethoxy-2,4-dioxo-1H-quinazolin-3-yl)-N-(2-phenylethyl)hexanamide |
|---|---|
| PubChem CID | 15988281 |
| Molecular Formula | C24H29N3O5 |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.21 |
| IUPAC Name | 6-(6,7-dimethoxy-2,4-dioxo-1H-quinazolin-3-yl)-N-(2-phenylethyl)hexanamide |
| SMILES | COc1cc2[nH]c(=O)n(CCCCCC(=O)NCCc3ccccc3)c(=O)c2cc1OC |
| InChI | InChI=1S/C24H29N3O5/c1-31-20-15-18-19(16-21(20)32-2)26-24(30)27(23(18)29)14-8-4-7-11-22(28)25-13-12-17-9-5-3-6-10-17/h3,5-6,9-10,15-16H,4,7-8,11-14H2,1-2H3,(H,25,28)(H,26,30) |
| InChIKey | KCXCXTGDNUCTSO-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|