C18H19N3O4 — CID 66502564
3-(2-anilinoethyl)-6,7-dimethoxy-1H-quinazoline-2,4-dione (PubChem CID 66502564) has the molecular formula C18H19N3O4 and a molecular weight of 341.37 g/mol. Its IUPAC name is 3-(2-anilinoethyl)-6,7-dimethoxy-1H-quinazoline-2,4-dione.
| Compound Name | 3-(2-anilinoethyl)-6,7-dimethoxy-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 66502564 |
| Molecular Formula | C18H19N3O4 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 3-(2-anilinoethyl)-6,7-dimethoxy-1H-quinazoline-2,4-dione |
| SMILES | COc1cc2[nH]c(=O)n(CCNc3ccccc3)c(=O)c2cc1OC |
| InChI | InChI=1S/C18H19N3O4/c1-24-15-10-13-14(11-16(15)25-2)20-18(23)21(17(13)22)9-8-19-12-6-4-3-5-7-12/h3-7,10-11,19H,8-9H2,1-2H3,(H,20,23) |
| InChIKey | VBPYJZZTCNZEKY-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 85.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |