C13H16N2O4 — CID 94075074
6,7-dimethoxy-3-propyl-1H-quinazoline-2,4-dione (PubChem CID 94075074) has the molecular formula C13H16N2O4 and a molecular weight of 264.28 g/mol. Its IUPAC name is 6,7-dimethoxy-3-propyl-1H-quinazoline-2,4-dione.
| Compound Name | 6,7-dimethoxy-3-propyl-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 94075074 |
| Molecular Formula | C13H16N2O4 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | 6,7-dimethoxy-3-propyl-1H-quinazoline-2,4-dione |
| SMILES | CCCn1c(=O)[nH]c2cc(OC)c(OC)cc2c1=O |
| InChI | InChI=1S/C13H16N2O4/c1-4-5-15-12(16)8-6-10(18-2)11(19-3)7-9(8)14-13(15)17/h6-7H,4-5H2,1-3H3,(H,14,17) |
| InChIKey | VGVUSTVIRDCATI-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |