About 6,7-dimethoxy-3-propyl-1H-quinazoline-2,4-dione
6,7-dimethoxy-3-propyl-1H-quinazoline-2,4-dione (PubChem CID 94075074) has the molecular formula C13H16N2O4
and a molecular weight of 264.28 g/mol. Its IUPAC name is 6,7-dimethoxy-3-propyl-1H-quinazoline-2,4-dione.
Molecular Properties
| Compound Name | 6,7-dimethoxy-3-propyl-1H-quinazoline-2,4-dione |
| PubChem CID | 94075074 |
| Molecular Formula | C13H16N2O4 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | 6,7-dimethoxy-3-propyl-1H-quinazoline-2,4-dione |
| SMILES | CCCn1c(=O)[nH]c2cc(OC)c(OC)cc2c1=O |
| InChI | InChI=1S/C13H16N2O4/c1-4-5-15-12(16)8-6-10(18-2)11(19-3)7-9(8)14-13(15)17/h6-7H,4-5H2,1-3H3,(H,14,17) |
| InChIKey | VGVUSTVIRDCATI-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6,7-dimethoxy-3-propyl-1H-quinazoline-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dimethoxy-3-propyl-1H-quinazoline-2,4-dione?
The IUPAC name of 6,7-dimethoxy-3-propyl-1H-quinazoline-2,4-dione (CID 94075074) is 6,7-dimethoxy-3-propyl-1H-quinazoline-2,4-dione.
What is the SMILES notation for 6,7-dimethoxy-3-propyl-1H-quinazoline-2,4-dione?
The canonical SMILES for 6,7-dimethoxy-3-propyl-1H-quinazoline-2,4-dione is CCCn1c(=O)[nH]c2cc(OC)c(OC)cc2c1=O.
What is the InChIKey of 6,7-dimethoxy-3-propyl-1H-quinazoline-2,4-dione?
The InChIKey is VGVUSTVIRDCATI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2O4/c1-4-5-15-12(16)8-6-10(18-2)11(19-3)7-9(8)14-13(15)17/h6-7H,4-5H2,1-3H3,(H,14,17).
What are the key properties of 6,7-dimethoxy-3-propyl-1H-quinazoline-2,4-dione?
6,7-dimethoxy-3-propyl-1H-quinazoline-2,4-dione has a molecular weight of 264.28 g/mol, XLogP of 1.12, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dimethoxy-3-propyl-1H-quinazoline-2,4-dione is sourced from PubChem (CID 94075074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).