C14H18N2O4 — CID 54253740
3-butyl-5,6-dimethoxy-1H-quinazoline-2,4-dione (PubChem CID 54253740) has the molecular formula C14H18N2O4 and a molecular weight of 278.31 g/mol. Its IUPAC name is 3-butyl-5,6-dimethoxy-1H-quinazoline-2,4-dione.
| Compound Name | 3-butyl-5,6-dimethoxy-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 54253740 |
| Molecular Formula | C14H18N2O4 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 3-butyl-5,6-dimethoxy-1H-quinazoline-2,4-dione |
| SMILES | CCCCn1c(=O)[nH]c2ccc(OC)c(OC)c2c1=O |
| InChI | InChI=1S/C14H18N2O4/c1-4-5-8-16-13(17)11-9(15-14(16)18)6-7-10(19-2)12(11)20-3/h6-7H,4-5,8H2,1-3H3,(H,15,18) |
| InChIKey | QYOUBUPGFYYXAS-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |