C12H14N2O5S — CID 22642117
3-butyl-2,4-dioxo-1H-quinazoline-5-sulfonic acid (PubChem CID 22642117) has the molecular formula C12H14N2O5S and a molecular weight of 298.32 g/mol. Its IUPAC name is 3-butyl-2,4-dioxo-1H-quinazoline-5-sulfonic acid.
| Compound Name | 3-butyl-2,4-dioxo-1H-quinazoline-5-sulfonic acid |
|---|---|
| PubChem CID | 22642117 |
| Molecular Formula | C12H14N2O5S |
| Molecular Weight | 298.32 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | 3-butyl-2,4-dioxo-1H-quinazoline-5-sulfonic acid |
| SMILES | CCCCn1c(=O)[nH]c2cccc(S(=O)(=O)O)c2c1=O |
| InChI | InChI=1S/C12H14N2O5S/c1-2-3-7-14-11(15)10-8(13-12(14)16)5-4-6-9(10)20(17,18)19/h4-6H,2-3,7H2,1H3,(H,13,16)(H,17,18,19) |
| InChIKey | LLHJFYLNMVTYRE-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 109.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.32 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|