3-butyl-2,4-dioxo-1H-quinazoline-5-sulfonic acid

C12H14N2O5S — CID 22642117

IUPAC3-butyl-2,4-dioxo-1H-quinazoline-5-sulfonic acid
SMILESCCCCn1c(=O)[nH]c2cccc(S(=O)(=O)O)c2c1=O
InChIInChI=1S/C12H14N2O5S/c1-2-3-7-14-11(15)10-8(13-12(14)16)5-4-6-9(10)20(17,18)19/h4-6H,2-3,7H2,1H3,(H,13,16)(H,17,18,19)
InChIKeyLLHJFYLNMVTYRE-UHFFFAOYSA-N
MW298.32 g/mol
LogP0.74
Rot. Bonds4

About 3-butyl-2,4-dioxo-1H-quinazoline-5-sulfonic acid

3-butyl-2,4-dioxo-1H-quinazoline-5-sulfonic acid (PubChem CID 22642117) has the molecular formula C12H14N2O5S and a molecular weight of 298.32 g/mol. Its IUPAC name is 3-butyl-2,4-dioxo-1H-quinazoline-5-sulfonic acid.

Molecular Properties

Compound Name3-butyl-2,4-dioxo-1H-quinazoline-5-sulfonic acid
PubChem CID22642117
Molecular FormulaC12H14N2O5S
Molecular Weight298.32 g/mol
Exact Mass298.06
IUPAC Name3-butyl-2,4-dioxo-1H-quinazoline-5-sulfonic acid
SMILESCCCCn1c(=O)[nH]c2cccc(S(=O)(=O)O)c2c1=O
InChIInChI=1S/C12H14N2O5S/c1-2-3-7-14-11(15)10-8(13-12(14)16)5-4-6-9(10)20(17,18)19/h4-6H,2-3,7H2,1H3,(H,13,16)(H,17,18,19)
InChIKeyLLHJFYLNMVTYRE-UHFFFAOYSA-N
XLogP0.74
TPSA109.23 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500298.32
LogP ≤ 50.74
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 3-butyl-2,4-dioxo-1H-quinazoline-5-sulfonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-butyl-2,4-dioxo-1H-quinazoline-5-sulfonic acid?
The IUPAC name of 3-butyl-2,4-dioxo-1H-quinazoline-5-sulfonic acid (CID 22642117) is 3-butyl-2,4-dioxo-1H-quinazoline-5-sulfonic acid.
What is the SMILES notation for 3-butyl-2,4-dioxo-1H-quinazoline-5-sulfonic acid?
The canonical SMILES for 3-butyl-2,4-dioxo-1H-quinazoline-5-sulfonic acid is CCCCn1c(=O)[nH]c2cccc(S(=O)(=O)O)c2c1=O.
What is the InChIKey of 3-butyl-2,4-dioxo-1H-quinazoline-5-sulfonic acid?
The InChIKey is LLHJFYLNMVTYRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2O5S/c1-2-3-7-14-11(15)10-8(13-12(14)16)5-4-6-9(10)20(17,18)19/h4-6H,2-3,7H2,1H3,(H,13,16)(H,17,18,19).
What are the key properties of 3-butyl-2,4-dioxo-1H-quinazoline-5-sulfonic acid?
3-butyl-2,4-dioxo-1H-quinazoline-5-sulfonic acid has a molecular weight of 298.32 g/mol, XLogP of 0.74, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butyl-2,4-dioxo-1H-quinazoline-5-sulfonic acid is sourced from PubChem (CID 22642117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).