C12H14N2O3 — CID 117261902
8-methoxy-3-propyl-1H-quinazoline-2,4-dione (PubChem CID 117261902) has the molecular formula C12H14N2O3 and a molecular weight of 234.25 g/mol. Its IUPAC name is 8-methoxy-3-propyl-1H-quinazoline-2,4-dione.
| Compound Name | 8-methoxy-3-propyl-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 117261902 |
| Molecular Formula | C12H14N2O3 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | 8-methoxy-3-propyl-1H-quinazoline-2,4-dione |
| SMILES | CCCn1c(=O)[nH]c2c(OC)cccc2c1=O |
| InChI | InChI=1S/C12H14N2O3/c1-3-7-14-11(15)8-5-4-6-9(17-2)10(8)13-12(14)16/h4-6H,3,7H2,1-2H3,(H,13,16) |
| InChIKey | USPUWADQRWYLCI-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |