C13H16N2O3 — CID 117261904
8-methoxy-3-(2-methylpropyl)-1H-quinazoline-2,4-dione (PubChem CID 117261904) has the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. Its IUPAC name is 8-methoxy-3-(2-methylpropyl)-1H-quinazoline-2,4-dione.
| Compound Name | 8-methoxy-3-(2-methylpropyl)-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 117261904 |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | 8-methoxy-3-(2-methylpropyl)-1H-quinazoline-2,4-dione |
| SMILES | COc1cccc2c(=O)n(CC(C)C)c(=O)[nH]c12 |
| InChI | InChI=1S/C13H16N2O3/c1-8(2)7-15-12(16)9-5-4-6-10(18-3)11(9)14-13(15)17/h4-6,8H,7H2,1-3H3,(H,14,17) |
| InChIKey | ZPVINTARVWQCSW-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |