C18H25N3O5 — CID 22423308
N-butyl-4-(6,7-dimethoxy-2,4-dioxo-1H-quinazolin-3-yl)butanamide (PubChem CID 22423308) has the molecular formula C18H25N3O5 and a molecular weight of 363.41 g/mol. Its IUPAC name is N-butyl-4-(6,7-dimethoxy-2,4-dioxo-1H-quinazolin-3-yl)butanamide.
| Compound Name | N-butyl-4-(6,7-dimethoxy-2,4-dioxo-1H-quinazolin-3-yl)butanamide |
|---|---|
| PubChem CID | 22423308 |
| Molecular Formula | C18H25N3O5 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | N-butyl-4-(6,7-dimethoxy-2,4-dioxo-1H-quinazolin-3-yl)butanamide |
| SMILES | CCCCNC(=O)CCCn1c(=O)[nH]c2cc(OC)c(OC)cc2c1=O |
| InChI | InChI=1S/C18H25N3O5/c1-4-5-8-19-16(22)7-6-9-21-17(23)12-10-14(25-2)15(26-3)11-13(12)20-18(21)24/h10-11H,4-9H2,1-3H3,(H,19,22)(H,20,24) |
| InChIKey | CEAQEQXDJXVCBS-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|