About N-cycloheptyl-4-(6,7-diethoxy-2,4-dioxo-1H-quinazolin-3-yl)butanamide
N-cycloheptyl-4-(6,7-diethoxy-2,4-dioxo-1H-quinazolin-3-yl)butanamide (PubChem CID 22588192) has the molecular formula C23H33N3O5
and a molecular weight of 431.53 g/mol. Its IUPAC name is N-cycloheptyl-4-(6,7-diethoxy-2,4-dioxo-1H-quinazolin-3-yl)butanamide.
Molecular Properties
| Compound Name | N-cycloheptyl-4-(6,7-diethoxy-2,4-dioxo-1H-quinazolin-3-yl)butanamide |
| PubChem CID | 22588192 |
| Molecular Formula | C23H33N3O5 |
| Molecular Weight | 431.53 g/mol |
| Exact Mass | 431.24 |
| IUPAC Name | N-cycloheptyl-4-(6,7-diethoxy-2,4-dioxo-1H-quinazolin-3-yl)butanamide |
| SMILES | CCOc1cc2[nH]c(=O)n(CCCC(=O)NC3CCCCCC3)c(=O)c2cc1OCC |
| InChI | InChI=1S/C23H33N3O5/c1-3-30-19-14-17-18(15-20(19)31-4-2)25-23(29)26(22(17)28)13-9-12-21(27)24-16-10-7-5-6-8-11-16/h14-16H,3-13H2,1-2H3,(H,24,27)(H,25,29) |
| InChIKey | KVNOZFLEWAVBCJ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 431.53 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-cycloheptyl-4-(6,7-diethoxy-2,4-dioxo-1H-quinazolin-3-yl)butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cycloheptyl-4-(6,7-diethoxy-2,4-dioxo-1H-quinazolin-3-yl)butanamide?
The IUPAC name of N-cycloheptyl-4-(6,7-diethoxy-2,4-dioxo-1H-quinazolin-3-yl)butanamide (CID 22588192) is N-cycloheptyl-4-(6,7-diethoxy-2,4-dioxo-1H-quinazolin-3-yl)butanamide.
What is the SMILES notation for N-cycloheptyl-4-(6,7-diethoxy-2,4-dioxo-1H-quinazolin-3-yl)butanamide?
The canonical SMILES for N-cycloheptyl-4-(6,7-diethoxy-2,4-dioxo-1H-quinazolin-3-yl)butanamide is CCOc1cc2[nH]c(=O)n(CCCC(=O)NC3CCCCCC3)c(=O)c2cc1OCC.
What is the InChIKey of N-cycloheptyl-4-(6,7-diethoxy-2,4-dioxo-1H-quinazolin-3-yl)butanamide?
The InChIKey is KVNOZFLEWAVBCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H33N3O5/c1-3-30-19-14-17-18(15-20(19)31-4-2)25-23(29)26(22(17)28)13-9-12-21(27)24-16-10-7-5-6-8-11-16/h14-16H,3-13H2,1-2H3,(H,24,27)(H,25,29).
What are the key properties of N-cycloheptyl-4-(6,7-diethoxy-2,4-dioxo-1H-quinazolin-3-yl)butanamide?
N-cycloheptyl-4-(6,7-diethoxy-2,4-dioxo-1H-quinazolin-3-yl)butanamide has a molecular weight of 431.53 g/mol, XLogP of 3.11, 9 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-cycloheptyl-4-(6,7-diethoxy-2,4-dioxo-1H-quinazolin-3-yl)butanamide is sourced from PubChem (CID 22588192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).