C28H35N3O5 — CID 46369041
3-[4-(4-benzylpiperidin-1-yl)-4-oxobutyl]-6,7-diethoxy-1H-quinazoline-2,4-dione (PubChem CID 46369041) has the molecular formula C28H35N3O5 and a molecular weight of 493.60 g/mol. Its IUPAC name is 3-[4-(4-benzylpiperidin-1-yl)-4-oxobutyl]-6,7-diethoxy-1H-quinazoline-2,4-dione.
| Compound Name | 3-[4-(4-benzylpiperidin-1-yl)-4-oxobutyl]-6,7-diethoxy-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 46369041 |
| Molecular Formula | C28H35N3O5 |
| Molecular Weight | 493.60 g/mol |
| Exact Mass | 493.26 |
| IUPAC Name | 3-[4-(4-benzylpiperidin-1-yl)-4-oxobutyl]-6,7-diethoxy-1H-quinazoline-2,4-dione |
| SMILES | CCOc1cc2[nH]c(=O)n(CCCC(=O)N3CCC(Cc4ccccc4)CC3)c(=O)c2cc1OCC |
| InChI | InChI=1S/C28H35N3O5/c1-3-35-24-18-22-23(19-25(24)36-4-2)29-28(34)31(27(22)33)14-8-11-26(32)30-15-12-21(13-16-30)17-20-9-6-5-7-10-20/h5-7,9-10,18-19,21H,3-4,8,11-17H2,1-2H3,(H,29,34) |
| InChIKey | SFHZCVRPIXQXJF-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 93.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.60 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |