C23H32N4O6S — CID 46370258
ethyl 4-[4-(6,7-diethoxy-4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)butanoyl]piperazine-1-carboxylate (PubChem CID 46370258) has the molecular formula C23H32N4O6S and a molecular weight of 492.60 g/mol. Its IUPAC name is ethyl 4-[4-(6,7-diethoxy-4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)butanoyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[4-(6,7-diethoxy-4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)butanoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 46370258 |
| Molecular Formula | C23H32N4O6S |
| Molecular Weight | 492.60 g/mol |
| Exact Mass | 492.20 |
| IUPAC Name | ethyl 4-[4-(6,7-diethoxy-4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)butanoyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)CCCn2c(=S)[nH]c3cc(OCC)c(OCC)cc3c2=O)CC1 |
| InChI | InChI=1S/C23H32N4O6S/c1-4-31-18-14-16-17(15-19(18)32-5-2)24-22(34)27(21(16)29)9-7-8-20(28)25-10-12-26(13-11-25)23(30)33-6-3/h14-15H,4-13H2,1-3H3,(H,24,34) |
| InChIKey | OTILZCAYGBPWPO-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 106.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.60 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|