C20H29N3O3S — CID 4100913
6,7-diethoxy-3-[2-(2-methylpiperidin-1-yl)ethyl]-2-sulfanylidene-1H-quinazolin-4-one (PubChem CID 4100913) has the molecular formula C20H29N3O3S and a molecular weight of 391.54 g/mol. Its IUPAC name is 6,7-diethoxy-3-[2-(2-methylpiperidin-1-yl)ethyl]-2-sulfanylidene-1H-quinazolin-4-one.
| Compound Name | 6,7-diethoxy-3-[2-(2-methylpiperidin-1-yl)ethyl]-2-sulfanylidene-1H-quinazolin-4-one |
|---|---|
| PubChem CID | 4100913 |
| Molecular Formula | C20H29N3O3S |
| Molecular Weight | 391.54 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | 6,7-diethoxy-3-[2-(2-methylpiperidin-1-yl)ethyl]-2-sulfanylidene-1H-quinazolin-4-one |
| SMILES | CCOc1cc2[nH]c(=S)n(CCN3CCCCC3C)c(=O)c2cc1OCC |
| InChI | InChI=1S/C20H29N3O3S/c1-4-25-17-12-15-16(13-18(17)26-5-2)21-20(27)23(19(15)24)11-10-22-9-7-6-8-14(22)3/h12-14H,4-11H2,1-3H3,(H,21,27) |
| InChIKey | IULJJIUOFBTKTH-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 59.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.54 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|