C17H22N2O5 — CID 4298608
6,7-diethoxy-3-(oxolan-2-ylmethyl)-1H-quinazoline-2,4-dione (PubChem CID 4298608) has the molecular formula C17H22N2O5 and a molecular weight of 334.37 g/mol. Its IUPAC name is 6,7-diethoxy-3-(oxolan-2-ylmethyl)-1H-quinazoline-2,4-dione.
| Compound Name | 6,7-diethoxy-3-(oxolan-2-ylmethyl)-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 4298608 |
| Molecular Formula | C17H22N2O5 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | 6,7-diethoxy-3-(oxolan-2-ylmethyl)-1H-quinazoline-2,4-dione |
| SMILES | CCOc1cc2[nH]c(=O)n(CC3CCCO3)c(=O)c2cc1OCC |
| InChI | InChI=1S/C17H22N2O5/c1-3-22-14-8-12-13(9-15(14)23-4-2)18-17(21)19(16(12)20)10-11-6-5-7-24-11/h8-9,11H,3-7,10H2,1-2H3,(H,18,21) |
| InChIKey | RVSHLJTXHCQIBP-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 82.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |