C26H31N3O5 — CID 4103926
N-cyclohexyl-4-[(6,7-diethoxy-2,4-dioxo-1H-quinazolin-3-yl)methyl]benzamide (PubChem CID 4103926) has the molecular formula C26H31N3O5 and a molecular weight of 465.55 g/mol. Its IUPAC name is N-cyclohexyl-4-[(6,7-diethoxy-2,4-dioxo-1H-quinazolin-3-yl)methyl]benzamide.
| Compound Name | N-cyclohexyl-4-[(6,7-diethoxy-2,4-dioxo-1H-quinazolin-3-yl)methyl]benzamide |
|---|---|
| PubChem CID | 4103926 |
| Molecular Formula | C26H31N3O5 |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.23 |
| IUPAC Name | N-cyclohexyl-4-[(6,7-diethoxy-2,4-dioxo-1H-quinazolin-3-yl)methyl]benzamide |
| SMILES | CCOc1cc2[nH]c(=O)n(Cc3ccc(C(=O)NC4CCCCC4)cc3)c(=O)c2cc1OCC |
| InChI | InChI=1S/C26H31N3O5/c1-3-33-22-14-20-21(15-23(22)34-4-2)28-26(32)29(25(20)31)16-17-10-12-18(13-11-17)24(30)27-19-8-6-5-7-9-19/h10-15,19H,3-9,16H2,1-2H3,(H,27,30)(H,28,32) |
| InChIKey | UPDXQDOBUDFIGL-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |