C22H24N2O3S — CID 7869185
2-[(2-ethoxyphenyl)methylsulfanyl]-3-[[(2R)-oxolan-2-yl]methyl]quinazolin-4-one (PubChem CID 7869185) has the molecular formula C22H24N2O3S and a molecular weight of 396.51 g/mol. Its IUPAC name is 2-[(2-ethoxyphenyl)methylsulfanyl]-3-[[(2R)-oxolan-2-yl]methyl]quinazolin-4-one.
| Compound Name | 2-[(2-ethoxyphenyl)methylsulfanyl]-3-[[(2R)-oxolan-2-yl]methyl]quinazolin-4-one |
|---|---|
| PubChem CID | 7869185 |
| Molecular Formula | C22H24N2O3S |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | 2-[(2-ethoxyphenyl)methylsulfanyl]-3-[[(2R)-oxolan-2-yl]methyl]quinazolin-4-one |
| SMILES | CCOc1ccccc1CSc1nc2ccccc2c(=O)n1C[C@H]1CCCO1 |
| InChI | InChI=1S/C22H24N2O3S/c1-2-26-20-12-6-3-8-16(20)15-28-22-23-19-11-5-4-10-18(19)21(25)24(22)14-17-9-7-13-27-17/h3-6,8,10-12,17H,2,7,9,13-15H2,1H3/t17-/m1/s1 |
| InChIKey | KWNBDJCNAYQMSZ-QGZVFWFLSA-N |
| XLogP | 4.27 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |