C17H24N2O3S — CID 5044544
6,7-diethoxy-3-(3-methylbutyl)-2-sulfanylidene-1H-quinazolin-4-one (PubChem CID 5044544) has the molecular formula C17H24N2O3S and a molecular weight of 336.46 g/mol. Its IUPAC name is 6,7-diethoxy-3-(3-methylbutyl)-2-sulfanylidene-1H-quinazolin-4-one.
| Compound Name | 6,7-diethoxy-3-(3-methylbutyl)-2-sulfanylidene-1H-quinazolin-4-one |
|---|---|
| PubChem CID | 5044544 |
| Molecular Formula | C17H24N2O3S |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | 6,7-diethoxy-3-(3-methylbutyl)-2-sulfanylidene-1H-quinazolin-4-one |
| SMILES | CCOc1cc2[nH]c(=S)n(CCC(C)C)c(=O)c2cc1OCC |
| InChI | InChI=1S/C17H24N2O3S/c1-5-21-14-9-12-13(10-15(14)22-6-2)18-17(23)19(16(12)20)8-7-11(3)4/h9-11H,5-8H2,1-4H3,(H,18,23) |
| InChIKey | RIFNMZMPDSNVRR-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 56.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|