C20H20N2O5S — CID 4163357
2-[4-(6,7-diethoxy-4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)phenyl]acetic acid (PubChem CID 4163357) has the molecular formula C20H20N2O5S and a molecular weight of 400.46 g/mol. Its IUPAC name is 2-[4-(6,7-diethoxy-4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)phenyl]acetic acid.
| Compound Name | 2-[4-(6,7-diethoxy-4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)phenyl]acetic acid |
|---|---|
| PubChem CID | 4163357 |
| Molecular Formula | C20H20N2O5S |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | 2-[4-(6,7-diethoxy-4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)phenyl]acetic acid |
| SMILES | CCOc1cc2[nH]c(=S)n(-c3ccc(CC(=O)O)cc3)c(=O)c2cc1OCC |
| InChI | InChI=1S/C20H20N2O5S/c1-3-26-16-10-14-15(11-17(16)27-4-2)21-20(28)22(19(14)25)13-7-5-12(6-8-13)9-18(23)24/h5-8,10-11H,3-4,9H2,1-2H3,(H,21,28)(H,23,24) |
| InChIKey | URKWCFCCQHYRGJ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 93.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|