C23H18N2O4S — CID 4298208
methyl 4-oxo-3-(4-phenylmethoxyphenyl)-2-sulfanylidene-1H-quinazoline-7-carboxylate (PubChem CID 4298208) has the molecular formula C23H18N2O4S and a molecular weight of 418.47 g/mol. Its IUPAC name is methyl 4-oxo-3-(4-phenylmethoxyphenyl)-2-sulfanylidene-1H-quinazoline-7-carboxylate.
| Compound Name | methyl 4-oxo-3-(4-phenylmethoxyphenyl)-2-sulfanylidene-1H-quinazoline-7-carboxylate |
|---|---|
| PubChem CID | 4298208 |
| Molecular Formula | C23H18N2O4S |
| Molecular Weight | 418.47 g/mol |
| Exact Mass | 418.10 |
| IUPAC Name | methyl 4-oxo-3-(4-phenylmethoxyphenyl)-2-sulfanylidene-1H-quinazoline-7-carboxylate |
| SMILES | COC(=O)c1ccc2c(=O)n(-c3ccc(OCc4ccccc4)cc3)c(=S)[nH]c2c1 |
| InChI | InChI=1S/C23H18N2O4S/c1-28-22(27)16-7-12-19-20(13-16)24-23(30)25(21(19)26)17-8-10-18(11-9-17)29-14-15-5-3-2-4-6-15/h2-13H,14H2,1H3,(H,24,30) |
| InChIKey | VQXZVSDAKOZYBC-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.47 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|