C26H23N3O6S — CID 46289182
methyl 3-[4-[(3,4-dimethoxyphenyl)methylcarbamoyl]phenyl]-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxylate (PubChem CID 46289182) has the molecular formula C26H23N3O6S and a molecular weight of 505.55 g/mol. Its IUPAC name is methyl 3-[4-[(3,4-dimethoxyphenyl)methylcarbamoyl]phenyl]-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxylate.
| Compound Name | methyl 3-[4-[(3,4-dimethoxyphenyl)methylcarbamoyl]phenyl]-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxylate |
|---|---|
| PubChem CID | 46289182 |
| Molecular Formula | C26H23N3O6S |
| Molecular Weight | 505.55 g/mol |
| Exact Mass | 505.13 |
| IUPAC Name | methyl 3-[4-[(3,4-dimethoxyphenyl)methylcarbamoyl]phenyl]-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxylate |
| SMILES | COC(=O)c1ccc2c(=O)n(-c3ccc(C(=O)NCc4ccc(OC)c(OC)c4)cc3)c(=S)[nH]c2c1 |
| InChI | InChI=1S/C26H23N3O6S/c1-33-21-11-4-15(12-22(21)34-2)14-27-23(30)16-5-8-18(9-6-16)29-24(31)19-10-7-17(25(32)35-3)13-20(19)28-26(29)36/h4-13H,14H2,1-3H3,(H,27,30)(H,28,36) |
| InChIKey | IHFVFEPJRXGMDZ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 111.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.55 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|