C27H21N3O4S — CID 4279776
3-(3,4-dimethoxyphenyl)-N-naphthalen-1-yl-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide (PubChem CID 4279776) has the molecular formula C27H21N3O4S and a molecular weight of 483.55 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-N-naphthalen-1-yl-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide.
| Compound Name | 3-(3,4-dimethoxyphenyl)-N-naphthalen-1-yl-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide |
|---|---|
| PubChem CID | 4279776 |
| Molecular Formula | C27H21N3O4S |
| Molecular Weight | 483.55 g/mol |
| Exact Mass | 483.13 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-N-naphthalen-1-yl-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide |
| SMILES | COc1ccc(-n2c(=S)[nH]c3cc(C(=O)Nc4cccc5ccccc45)ccc3c2=O)cc1OC |
| InChI | InChI=1S/C27H21N3O4S/c1-33-23-13-11-18(15-24(23)34-2)30-26(32)20-12-10-17(14-22(20)29-27(30)35)25(31)28-21-9-5-7-16-6-3-4-8-19(16)21/h3-15H,1-2H3,(H,28,31)(H,29,35) |
| InChIKey | XNOIZBYKNGKIBI-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 85.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.55 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|