C26H25FN4O5S — CID 126478539
N-(3,4-dimethoxyphenyl)-3-(4-fluorophenyl)-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide;N,N-dimethylformamide (PubChem CID 126478539) has the molecular formula C26H25FN4O5S and a molecular weight of 524.57 g/mol. Its IUPAC name is N-(3,4-dimethoxyphenyl)-3-(4-fluorophenyl)-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide;N,N-dimethylformamide.
| Compound Name | N-(3,4-dimethoxyphenyl)-3-(4-fluorophenyl)-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide;N,N-dimethylformamide |
|---|---|
| PubChem CID | 126478539 |
| Molecular Formula | C26H25FN4O5S |
| Molecular Weight | 524.57 g/mol |
| Exact Mass | 524.15 |
| IUPAC Name | N-(3,4-dimethoxyphenyl)-3-(4-fluorophenyl)-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide;N,N-dimethylformamide |
| SMILES | CN(C)C=O.COc1ccc(NC(=O)c2ccc3c(=O)n(-c4ccc(F)cc4)c(=S)[nH]c3c2)cc1OC |
| InChI | InChI=1S/C23H18FN3O4S.C3H7NO/c1-30-19-10-6-15(12-20(19)31-2)25-21(28)13-3-9-17-18(11-13)26-23(32)27(22(17)29)16-7-4-14(24)5-8-16;1-4(2)3-5/h3-12H,1-2H3,(H,25,28)(H,26,32);3H,1-2H3 |
| InChIKey | YPCYVZBNTMHMTN-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 105.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.57 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|