C21H13F2N3O2S — CID 23822188
N,3-bis(4-fluorophenyl)-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide (PubChem CID 23822188) has the molecular formula C21H13F2N3O2S and a molecular weight of 409.42 g/mol. Its IUPAC name is N,3-bis(4-fluorophenyl)-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide.
| Compound Name | N,3-bis(4-fluorophenyl)-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide |
|---|---|
| PubChem CID | 23822188 |
| Molecular Formula | C21H13F2N3O2S |
| Molecular Weight | 409.42 g/mol |
| Exact Mass | 409.07 |
| IUPAC Name | N,3-bis(4-fluorophenyl)-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide |
| SMILES | O=C(Nc1ccc(F)cc1)c1ccc2c(=O)n(-c3ccc(F)cc3)c(=S)[nH]c2c1 |
| InChI | InChI=1S/C21H13F2N3O2S/c22-13-2-6-15(7-3-13)24-19(27)12-1-10-17-18(11-12)25-21(29)26(20(17)28)16-8-4-14(23)5-9-16/h1-11H,(H,24,27)(H,25,29) |
| InChIKey | QLKNBILNWNNBNN-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 66.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.42 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|