C24H18F3N3O2S — CID 4080808
N-(3,4-dimethylphenyl)-4-oxo-2-sulfanylidene-3-[3-(trifluoromethyl)phenyl]-1H-quinazoline-7-carboxamide (PubChem CID 4080808) has the molecular formula C24H18F3N3O2S and a molecular weight of 469.49 g/mol. Its IUPAC name is N-(3,4-dimethylphenyl)-4-oxo-2-sulfanylidene-3-[3-(trifluoromethyl)phenyl]-1H-quinazoline-7-carboxamide.
| Compound Name | N-(3,4-dimethylphenyl)-4-oxo-2-sulfanylidene-3-[3-(trifluoromethyl)phenyl]-1H-quinazoline-7-carboxamide |
|---|---|
| PubChem CID | 4080808 |
| Molecular Formula | C24H18F3N3O2S |
| Molecular Weight | 469.49 g/mol |
| Exact Mass | 469.11 |
| IUPAC Name | N-(3,4-dimethylphenyl)-4-oxo-2-sulfanylidene-3-[3-(trifluoromethyl)phenyl]-1H-quinazoline-7-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2ccc3c(=O)n(-c4cccc(C(F)(F)F)c4)c(=S)[nH]c3c2)cc1C |
| InChI | InChI=1S/C24H18F3N3O2S/c1-13-6-8-17(10-14(13)2)28-21(31)15-7-9-19-20(11-15)29-23(33)30(22(19)32)18-5-3-4-16(12-18)24(25,26)27/h3-12H,1-2H3,(H,28,31)(H,29,33) |
| InChIKey | JVZWIXLYJXEUTR-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 66.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.49 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|