C23H19N3O2S — CID 15994607
N-(3,5-dimethylphenyl)-4-oxo-3-phenyl-2-sulfanylidene-1H-quinazoline-7-carboxamide (PubChem CID 15994607) has the molecular formula C23H19N3O2S and a molecular weight of 401.49 g/mol. Its IUPAC name is N-(3,5-dimethylphenyl)-4-oxo-3-phenyl-2-sulfanylidene-1H-quinazoline-7-carboxamide.
| Compound Name | N-(3,5-dimethylphenyl)-4-oxo-3-phenyl-2-sulfanylidene-1H-quinazoline-7-carboxamide |
|---|---|
| PubChem CID | 15994607 |
| Molecular Formula | C23H19N3O2S |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | N-(3,5-dimethylphenyl)-4-oxo-3-phenyl-2-sulfanylidene-1H-quinazoline-7-carboxamide |
| SMILES | Cc1cc(C)cc(NC(=O)c2ccc3c(=O)n(-c4ccccc4)c(=S)[nH]c3c2)c1 |
| InChI | InChI=1S/C23H19N3O2S/c1-14-10-15(2)12-17(11-14)24-21(27)16-8-9-19-20(13-16)25-23(29)26(22(19)28)18-6-4-3-5-7-18/h3-13H,1-2H3,(H,24,27)(H,25,29) |
| InChIKey | NVORZMPXEHVLSI-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 66.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|