C24H20N4O4S2 — CID 24646323
N-[3-(cyclopropylsulfamoyl)phenyl]-4-oxo-3-phenyl-2-sulfanylidene-1H-quinazoline-7-carboxamide (PubChem CID 24646323) has the molecular formula C24H20N4O4S2 and a molecular weight of 492.58 g/mol. Its IUPAC name is N-[3-(cyclopropylsulfamoyl)phenyl]-4-oxo-3-phenyl-2-sulfanylidene-1H-quinazoline-7-carboxamide.
| Compound Name | N-[3-(cyclopropylsulfamoyl)phenyl]-4-oxo-3-phenyl-2-sulfanylidene-1H-quinazoline-7-carboxamide |
|---|---|
| PubChem CID | 24646323 |
| Molecular Formula | C24H20N4O4S2 |
| Molecular Weight | 492.58 g/mol |
| Exact Mass | 492.09 |
| IUPAC Name | N-[3-(cyclopropylsulfamoyl)phenyl]-4-oxo-3-phenyl-2-sulfanylidene-1H-quinazoline-7-carboxamide |
| SMILES | O=C(Nc1cccc(S(=O)(=O)NC2CC2)c1)c1ccc2c(=O)n(-c3ccccc3)c(=S)[nH]c2c1 |
| InChI | InChI=1S/C24H20N4O4S2/c29-22(25-17-5-4-8-19(14-17)34(31,32)27-16-10-11-16)15-9-12-20-21(13-15)26-24(33)28(23(20)30)18-6-2-1-3-7-18/h1-9,12-14,16,27H,10-11H2,(H,25,29)(H,26,33) |
| InChIKey | YOSIMYYEFFRETL-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 113.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.58 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|