C23H16FN3O4S — CID 23908588
N-(1,3-benzodioxol-5-ylmethyl)-3-(4-fluorophenyl)-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide (PubChem CID 23908588) has the molecular formula C23H16FN3O4S and a molecular weight of 449.46 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-3-(4-fluorophenyl)-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-3-(4-fluorophenyl)-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide |
|---|---|
| PubChem CID | 23908588 |
| Molecular Formula | C23H16FN3O4S |
| Molecular Weight | 449.46 g/mol |
| Exact Mass | 449.08 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-3-(4-fluorophenyl)-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide |
| SMILES | O=C(NCc1ccc2c(c1)OCO2)c1ccc2c(=O)n(-c3ccc(F)cc3)c(=S)[nH]c2c1 |
| InChI | InChI=1S/C23H16FN3O4S/c24-15-3-5-16(6-4-15)27-22(29)17-7-2-14(10-18(17)26-23(27)32)21(28)25-11-13-1-8-19-20(9-13)31-12-30-19/h1-10H,11-12H2,(H,25,28)(H,26,32) |
| InChIKey | GQMSNBKWEZYMBA-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 85.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.46 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|