C24H18ClN3O4S — CID 4194139
N-(1,3-benzodioxol-5-ylmethyl)-3-[(2-chlorophenyl)methyl]-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide (PubChem CID 4194139) has the molecular formula C24H18ClN3O4S and a molecular weight of 479.95 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-3-[(2-chlorophenyl)methyl]-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-3-[(2-chlorophenyl)methyl]-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide |
|---|---|
| PubChem CID | 4194139 |
| Molecular Formula | C24H18ClN3O4S |
| Molecular Weight | 479.95 g/mol |
| Exact Mass | 479.07 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-3-[(2-chlorophenyl)methyl]-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide |
| SMILES | O=C(NCc1ccc2c(c1)OCO2)c1ccc2c(=O)n(Cc3ccccc3Cl)c(=S)[nH]c2c1 |
| InChI | InChI=1S/C24H18ClN3O4S/c25-18-4-2-1-3-16(18)12-28-23(30)17-7-6-15(10-19(17)27-24(28)33)22(29)26-11-14-5-8-20-21(9-14)32-13-31-20/h1-10H,11-13H2,(H,26,29)(H,27,33) |
| InChIKey | OCCQEJTXPZMRHV-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 85.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.95 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|