C26H18FN3O2S — CID 112816277
3-(2-fluorophenyl)-N-(naphthalen-2-ylmethyl)-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide (PubChem CID 112816277) has the molecular formula C26H18FN3O2S and a molecular weight of 455.51 g/mol. Its IUPAC name is 3-(2-fluorophenyl)-N-(naphthalen-2-ylmethyl)-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide.
| Compound Name | 3-(2-fluorophenyl)-N-(naphthalen-2-ylmethyl)-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide |
|---|---|
| PubChem CID | 112816277 |
| Molecular Formula | C26H18FN3O2S |
| Molecular Weight | 455.51 g/mol |
| Exact Mass | 455.11 |
| IUPAC Name | 3-(2-fluorophenyl)-N-(naphthalen-2-ylmethyl)-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide |
| SMILES | O=C(NCc1ccc2ccccc2c1)c1ccc2c(=O)n(-c3ccccc3F)c(=S)[nH]c2c1 |
| InChI | InChI=1S/C26H18FN3O2S/c27-21-7-3-4-8-23(21)30-25(32)20-12-11-19(14-22(20)29-26(30)33)24(31)28-15-16-9-10-17-5-1-2-6-18(17)13-16/h1-14H,15H2,(H,28,31)(H,29,33) |
| InChIKey | OYKAHVAYHRSUBK-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 66.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.51 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|