C18H13F4N3O2S2 — CID 112842778
3-(2-fluorophenyl)-4-oxo-2-sulfanylidene-N-[2-(trifluoromethylsulfanyl)ethyl]-1H-quinazoline-7-carboxamide (PubChem CID 112842778) has the molecular formula C18H13F4N3O2S2 and a molecular weight of 443.45 g/mol. Its IUPAC name is 3-(2-fluorophenyl)-4-oxo-2-sulfanylidene-N-[2-(trifluoromethylsulfanyl)ethyl]-1H-quinazoline-7-carboxamide.
| Compound Name | 3-(2-fluorophenyl)-4-oxo-2-sulfanylidene-N-[2-(trifluoromethylsulfanyl)ethyl]-1H-quinazoline-7-carboxamide |
|---|---|
| PubChem CID | 112842778 |
| Molecular Formula | C18H13F4N3O2S2 |
| Molecular Weight | 443.45 g/mol |
| Exact Mass | 443.04 |
| IUPAC Name | 3-(2-fluorophenyl)-4-oxo-2-sulfanylidene-N-[2-(trifluoromethylsulfanyl)ethyl]-1H-quinazoline-7-carboxamide |
| SMILES | O=C(NCCSC(F)(F)F)c1ccc2c(=O)n(-c3ccccc3F)c(=S)[nH]c2c1 |
| InChI | InChI=1S/C18H13F4N3O2S2/c19-12-3-1-2-4-14(12)25-16(27)11-6-5-10(9-13(11)24-17(25)28)15(26)23-7-8-29-18(20,21)22/h1-6,9H,7-8H2,(H,23,26)(H,24,28) |
| InChIKey | AKTFZFZBVPTVHJ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 66.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.45 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|