C25H22FN3O2S — CID 112816290
3-(2-fluorophenyl)-4-oxo-2-sulfanylidene-N-[(2,4,6-trimethylphenyl)methyl]-1H-quinazoline-7-carboxamide (PubChem CID 112816290) has the molecular formula C25H22FN3O2S and a molecular weight of 447.54 g/mol. Its IUPAC name is 3-(2-fluorophenyl)-4-oxo-2-sulfanylidene-N-[(2,4,6-trimethylphenyl)methyl]-1H-quinazoline-7-carboxamide.
| Compound Name | 3-(2-fluorophenyl)-4-oxo-2-sulfanylidene-N-[(2,4,6-trimethylphenyl)methyl]-1H-quinazoline-7-carboxamide |
|---|---|
| PubChem CID | 112816290 |
| Molecular Formula | C25H22FN3O2S |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.14 |
| IUPAC Name | 3-(2-fluorophenyl)-4-oxo-2-sulfanylidene-N-[(2,4,6-trimethylphenyl)methyl]-1H-quinazoline-7-carboxamide |
| SMILES | Cc1cc(C)c(CNC(=O)c2ccc3c(=O)n(-c4ccccc4F)c(=S)[nH]c3c2)c(C)c1 |
| InChI | InChI=1S/C25H22FN3O2S/c1-14-10-15(2)19(16(3)11-14)13-27-23(30)17-8-9-18-21(12-17)28-25(32)29(24(18)31)22-7-5-4-6-20(22)26/h4-12H,13H2,1-3H3,(H,27,30)(H,28,32) |
| InChIKey | QXPODQCLBZHRPC-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 66.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|