C23H17ClFN3O3S — CID 112827582
N-[2-(3-chlorophenoxy)ethyl]-3-(2-fluorophenyl)-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide (PubChem CID 112827582) has the molecular formula C23H17ClFN3O3S and a molecular weight of 469.93 g/mol. Its IUPAC name is N-[2-(3-chlorophenoxy)ethyl]-3-(2-fluorophenyl)-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide.
| Compound Name | N-[2-(3-chlorophenoxy)ethyl]-3-(2-fluorophenyl)-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide |
|---|---|
| PubChem CID | 112827582 |
| Molecular Formula | C23H17ClFN3O3S |
| Molecular Weight | 469.93 g/mol |
| Exact Mass | 469.07 |
| IUPAC Name | N-[2-(3-chlorophenoxy)ethyl]-3-(2-fluorophenyl)-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide |
| SMILES | O=C(NCCOc1cccc(Cl)c1)c1ccc2c(=O)n(-c3ccccc3F)c(=S)[nH]c2c1 |
| InChI | InChI=1S/C23H17ClFN3O3S/c24-15-4-3-5-16(13-15)31-11-10-26-21(29)14-8-9-17-19(12-14)27-23(32)28(22(17)30)20-7-2-1-6-18(20)25/h1-9,12-13H,10-11H2,(H,26,29)(H,27,32) |
| InChIKey | VILBSSYOFPYGQN-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 76.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.93 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|