C24H22FN5O2S — CID 112842711
N-[6-(diethylamino)-3-pyridinyl]-3-(2-fluorophenyl)-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide (PubChem CID 112842711) has the molecular formula C24H22FN5O2S and a molecular weight of 463.54 g/mol. Its IUPAC name is N-[6-(diethylamino)-3-pyridinyl]-3-(2-fluorophenyl)-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide.
| Compound Name | N-[6-(diethylamino)-3-pyridinyl]-3-(2-fluorophenyl)-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide |
|---|---|
| PubChem CID | 112842711 |
| Molecular Formula | C24H22FN5O2S |
| Molecular Weight | 463.54 g/mol |
| Exact Mass | 463.15 |
| IUPAC Name | N-[6-(diethylamino)-3-pyridinyl]-3-(2-fluorophenyl)-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide |
| SMILES | CCN(CC)c1ccc(NC(=O)c2ccc3c(=O)n(-c4ccccc4F)c(=S)[nH]c3c2)cn1 |
| InChI | InChI=1S/C24H22FN5O2S/c1-3-29(4-2)21-12-10-16(14-26-21)27-22(31)15-9-11-17-19(13-15)28-24(33)30(23(17)32)20-8-6-5-7-18(20)25/h5-14H,3-4H2,1-2H3,(H,27,31)(H,28,33) |
| InChIKey | NYWNAFZZJFDIBN-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 83.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.54 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|