C12H10N2O5S — CID 27440469
2-(7-methoxycarbonyl-4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)acetic acid (PubChem CID 27440469) has the molecular formula C12H10N2O5S and a molecular weight of 294.29 g/mol. Its IUPAC name is 2-(7-methoxycarbonyl-4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)acetic acid.
| Compound Name | 2-(7-methoxycarbonyl-4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)acetic acid |
|---|---|
| PubChem CID | 27440469 |
| Molecular Formula | C12H10N2O5S |
| Molecular Weight | 294.29 g/mol |
| Exact Mass | 294.03 |
| IUPAC Name | 2-(7-methoxycarbonyl-4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)acetic acid |
| SMILES | COC(=O)c1ccc2c(=O)n(CC(=O)O)c(=S)[nH]c2c1 |
| InChI | InChI=1S/C12H10N2O5S/c1-19-11(18)6-2-3-7-8(4-6)13-12(20)14(10(7)17)5-9(15)16/h2-4H,5H2,1H3,(H,13,20)(H,15,16) |
| InChIKey | UTAJHEBPNMUQPV-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 101.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.29 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|