C23H26N4O4S — CID 42585644
methyl 3-[2-[4-(4-methoxyphenyl)piperazin-1-yl]ethyl]-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxylate (PubChem CID 42585644) has the molecular formula C23H26N4O4S and a molecular weight of 454.55 g/mol. Its IUPAC name is methyl 3-[2-[4-(4-methoxyphenyl)piperazin-1-yl]ethyl]-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxylate.
| Compound Name | methyl 3-[2-[4-(4-methoxyphenyl)piperazin-1-yl]ethyl]-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxylate |
|---|---|
| PubChem CID | 42585644 |
| Molecular Formula | C23H26N4O4S |
| Molecular Weight | 454.55 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | methyl 3-[2-[4-(4-methoxyphenyl)piperazin-1-yl]ethyl]-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxylate |
| SMILES | COC(=O)c1ccc2c(=O)n(CCN3CCN(c4ccc(OC)cc4)CC3)c(=S)[nH]c2c1 |
| InChI | InChI=1S/C23H26N4O4S/c1-30-18-6-4-17(5-7-18)26-12-9-25(10-13-26)11-14-27-21(28)19-8-3-16(22(29)31-2)15-20(19)24-23(27)32/h3-8,15H,9-14H2,1-2H3,(H,24,32) |
| InChIKey | LRTYBBPPKPWEPU-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.55 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|