C17H13N2O4S- — CID 3606275
3-[(4-methoxyphenyl)methyl]-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxylate (PubChem CID 3606275) has the molecular formula C17H13N2O4S- and a molecular weight of 341.37 g/mol. Its IUPAC name is 3-[(4-methoxyphenyl)methyl]-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxylate.
| Compound Name | 3-[(4-methoxyphenyl)methyl]-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxylate |
|---|---|
| PubChem CID | 3606275 |
| Molecular Formula | C17H13N2O4S- |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.06 |
| IUPAC Name | 3-[(4-methoxyphenyl)methyl]-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxylate |
| SMILES | COc1ccc(Cn2c(=S)[nH]c3cc(C(=O)[O-])ccc3c2=O)cc1 |
| InChI | InChI=1S/C17H14N2O4S/c1-23-12-5-2-10(3-6-12)9-19-15(20)13-7-4-11(16(21)22)8-14(13)18-17(19)24/h2-8H,9H2,1H3,(H,18,24)(H,21,22)/p-1 |
| InChIKey | MZKAVTDRAOVZKS-UHFFFAOYSA-M |
| XLogP | 1.48 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|