C17H11N2O5S- — CID 3591261
4-[(8-oxo-6-sulfanylidene-5H-[1,3]dioxolo[4,5-g]quinazolin-7-yl)methyl]benzoate (PubChem CID 3591261) has the molecular formula C17H11N2O5S- and a molecular weight of 355.35 g/mol. Its IUPAC name is 4-[(8-oxo-6-sulfanylidene-5H-[1,3]dioxolo[4,5-g]quinazolin-7-yl)methyl]benzoate.
| Compound Name | 4-[(8-oxo-6-sulfanylidene-5H-[1,3]dioxolo[4,5-g]quinazolin-7-yl)methyl]benzoate |
|---|---|
| PubChem CID | 3591261 |
| Molecular Formula | C17H11N2O5S- |
| Molecular Weight | 355.35 g/mol |
| Exact Mass | 355.04 |
| IUPAC Name | 4-[(8-oxo-6-sulfanylidene-5H-[1,3]dioxolo[4,5-g]quinazolin-7-yl)methyl]benzoate |
| SMILES | O=C([O-])c1ccc(Cn2c(=S)[nH]c3cc4c(cc3c2=O)OCO4)cc1 |
| InChI | InChI=1S/C17H12N2O5S/c20-15-11-5-13-14(24-8-23-13)6-12(11)18-17(25)19(15)7-9-1-3-10(4-2-9)16(21)22/h1-6H,7-8H2,(H,18,25)(H,21,22)/p-1 |
| InChIKey | SZCICMHIUXYBRQ-UHFFFAOYSA-M |
| XLogP | 1.20 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.35 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|