C17H12Cl2N2O3S — CID 4641991
methyl 3-[(3,4-dichlorophenyl)methyl]-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxylate (PubChem CID 4641991) has the molecular formula C17H12Cl2N2O3S and a molecular weight of 395.27 g/mol. Its IUPAC name is methyl 3-[(3,4-dichlorophenyl)methyl]-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxylate.
| Compound Name | methyl 3-[(3,4-dichlorophenyl)methyl]-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxylate |
|---|---|
| PubChem CID | 4641991 |
| Molecular Formula | C17H12Cl2N2O3S |
| Molecular Weight | 395.27 g/mol |
| Exact Mass | 393.99 |
| IUPAC Name | methyl 3-[(3,4-dichlorophenyl)methyl]-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxylate |
| SMILES | COC(=O)c1ccc2c(=O)n(Cc3ccc(Cl)c(Cl)c3)c(=S)[nH]c2c1 |
| InChI | InChI=1S/C17H12Cl2N2O3S/c1-24-16(23)10-3-4-11-14(7-10)20-17(25)21(15(11)22)8-9-2-5-12(18)13(19)6-9/h2-7H,8H2,1H3,(H,20,25) |
| InChIKey | YWFFFPHAJNZUBM-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.27 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|