C25H28N4O4S — CID 27371288
methyl 4-oxo-3-[[4-(2-piperidin-1-ylethylcarbamoyl)phenyl]methyl]-2-sulfanylidene-1H-quinazoline-7-carboxylate (PubChem CID 27371288) has the molecular formula C25H28N4O4S and a molecular weight of 480.59 g/mol. Its IUPAC name is methyl 4-oxo-3-[[4-(2-piperidin-1-ylethylcarbamoyl)phenyl]methyl]-2-sulfanylidene-1H-quinazoline-7-carboxylate.
| Compound Name | methyl 4-oxo-3-[[4-(2-piperidin-1-ylethylcarbamoyl)phenyl]methyl]-2-sulfanylidene-1H-quinazoline-7-carboxylate |
|---|---|
| PubChem CID | 27371288 |
| Molecular Formula | C25H28N4O4S |
| Molecular Weight | 480.59 g/mol |
| Exact Mass | 480.18 |
| IUPAC Name | methyl 4-oxo-3-[[4-(2-piperidin-1-ylethylcarbamoyl)phenyl]methyl]-2-sulfanylidene-1H-quinazoline-7-carboxylate |
| SMILES | COC(=O)c1ccc2c(=O)n(Cc3ccc(C(=O)NCCN4CCCCC4)cc3)c(=S)[nH]c2c1 |
| InChI | InChI=1S/C25H28N4O4S/c1-33-24(32)19-9-10-20-21(15-19)27-25(34)29(23(20)31)16-17-5-7-18(8-6-17)22(30)26-11-14-28-12-3-2-4-13-28/h5-10,15H,2-4,11-14,16H2,1H3,(H,26,30)(H,27,34) |
| InChIKey | SLNKYQUQADRHFD-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 96.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.59 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|