C23H25N3O4S — CID 92866088
methyl 4-oxo-3-[4-oxo-4-[[(2R)-2-phenylpropyl]amino]butyl]-2-sulfanylidene-1H-quinazoline-7-carboxylate (PubChem CID 92866088) has the molecular formula C23H25N3O4S and a molecular weight of 439.54 g/mol. Its IUPAC name is methyl 4-oxo-3-[4-oxo-4-[[(2R)-2-phenylpropyl]amino]butyl]-2-sulfanylidene-1H-quinazoline-7-carboxylate.
| Compound Name | methyl 4-oxo-3-[4-oxo-4-[[(2R)-2-phenylpropyl]amino]butyl]-2-sulfanylidene-1H-quinazoline-7-carboxylate |
|---|---|
| PubChem CID | 92866088 |
| Molecular Formula | C23H25N3O4S |
| Molecular Weight | 439.54 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | methyl 4-oxo-3-[4-oxo-4-[[(2R)-2-phenylpropyl]amino]butyl]-2-sulfanylidene-1H-quinazoline-7-carboxylate |
| SMILES | COC(=O)c1ccc2c(=O)n(CCCC(=O)NC[C@H](C)c3ccccc3)c(=S)[nH]c2c1 |
| InChI | InChI=1S/C23H25N3O4S/c1-15(16-7-4-3-5-8-16)14-24-20(27)9-6-12-26-21(28)18-11-10-17(22(29)30-2)13-19(18)25-23(26)31/h3-5,7-8,10-11,13,15H,6,9,12,14H2,1-2H3,(H,24,27)(H,25,31)/t15-/m0/s1 |
| InChIKey | RATMQFMLKACBFF-HNNXBMFYSA-N |
| XLogP | 3.55 |
| TPSA | 93.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.54 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|