C23H28N4O4S — CID 4159852
5-(6,7-diethoxy-4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)-N-(pyridin-3-ylmethyl)pentanamide (PubChem CID 4159852) has the molecular formula C23H28N4O4S and a molecular weight of 456.57 g/mol. Its IUPAC name is 5-(6,7-diethoxy-4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)-N-(pyridin-3-ylmethyl)pentanamide.
| Compound Name | 5-(6,7-diethoxy-4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)-N-(pyridin-3-ylmethyl)pentanamide |
|---|---|
| PubChem CID | 4159852 |
| Molecular Formula | C23H28N4O4S |
| Molecular Weight | 456.57 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | 5-(6,7-diethoxy-4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)-N-(pyridin-3-ylmethyl)pentanamide |
| SMILES | CCOc1cc2[nH]c(=S)n(CCCCC(=O)NCc3cccnc3)c(=O)c2cc1OCC |
| InChI | InChI=1S/C23H28N4O4S/c1-3-30-19-12-17-18(13-20(19)31-4-2)26-23(32)27(22(17)29)11-6-5-9-21(28)25-15-16-8-7-10-24-14-16/h7-8,10,12-14H,3-6,9,11,15H2,1-2H3,(H,25,28)(H,26,32) |
| InChIKey | VWRPPSFSEKCEKN-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 98.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.57 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|