C19H24N6O2S2 — CID 56543554
N-[(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-6-(4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)hexanamide (PubChem CID 56543554) has the molecular formula C19H24N6O2S2 and a molecular weight of 432.58 g/mol. Its IUPAC name is N-[(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-6-(4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)hexanamide.
| Compound Name | N-[(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-6-(4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)hexanamide |
|---|---|
| PubChem CID | 56543554 |
| Molecular Formula | C19H24N6O2S2 |
| Molecular Weight | 432.58 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | N-[(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-6-(4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)hexanamide |
| SMILES | CCn1c(CNC(=O)CCCCCn2c(=S)[nH]c3ccccc3c2=O)n[nH]c1=S |
| InChI | InChI=1S/C19H24N6O2S2/c1-2-24-15(22-23-19(24)29)12-20-16(26)10-4-3-7-11-25-17(27)13-8-5-6-9-14(13)21-18(25)28/h5-6,8-9H,2-4,7,10-12H2,1H3,(H,20,26)(H,21,28)(H,23,29) |
| InChIKey | YDRVWIPOQFURIN-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 100.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.58 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|