C21H26N4O2S — CID 31218879
N-[(1,5-dimethylpyrrol-2-yl)methyl]-6-(4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)hexanamide (PubChem CID 31218879) has the molecular formula C21H26N4O2S and a molecular weight of 398.53 g/mol. Its IUPAC name is N-[(1,5-dimethylpyrrol-2-yl)methyl]-6-(4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)hexanamide.
| Compound Name | N-[(1,5-dimethylpyrrol-2-yl)methyl]-6-(4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)hexanamide |
|---|---|
| PubChem CID | 31218879 |
| Molecular Formula | C21H26N4O2S |
| Molecular Weight | 398.53 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | N-[(1,5-dimethylpyrrol-2-yl)methyl]-6-(4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)hexanamide |
| SMILES | Cc1ccc(CNC(=O)CCCCCn2c(=S)[nH]c3ccccc3c2=O)n1C |
| InChI | InChI=1S/C21H26N4O2S/c1-15-11-12-16(24(15)2)14-22-19(26)10-4-3-7-13-25-20(27)17-8-5-6-9-18(17)23-21(25)28/h5-6,8-9,11-12H,3-4,7,10,13-14H2,1-2H3,(H,22,26)(H,23,28) |
| InChIKey | PVRFPCVLWGFHEO-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 71.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.53 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|